Structure of PDB 1nf8 Chain A Binding Site BS01 |
|
|
Ligand ID | ISC |
InChI | InChI=1S/C10H10O6/c1-5(9(12)13)16-7-4-2-3-6(8(7)11)10(14)15/h2-4,7-8,11H,1H2,(H,12,13)(H,14,15)/t7-,8-/m0/s1 |
InChIKey | NTGWPRCCOQCMGE-YUMQZZPRSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(O)C1=CC=CC(O/C(C(=O)O)=C)C1O | OpenEye OEToolkits 1.7.2 | C=C(C(=O)O)O[C@H]1C=CC=C([C@@H]1O)C(=O)O | CACTVS 3.370 | O[C@@H]1[C@@H](OC(=C)C(O)=O)C=CC=C1C(O)=O | CACTVS 3.370 | O[CH]1[CH](OC(=C)C(O)=O)C=CC=C1C(O)=O | OpenEye OEToolkits 1.7.2 | C=C(C(=O)O)OC1C=CC=C(C1O)C(=O)O |
|
Formula | C10 H10 O6 |
Name | (5S,6S)-5-[(1-carboxyethenyl)oxy]-6-hydroxycyclohexa-1,3-diene-1-carboxylic acid; ISOCHORISMIC ACID |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 1nf8 Chain A Residue 220
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
H37 A38 K122 |
Catalytic site (residue number reindexed from 1) |
H37 A38 K122 |
Enzyme Commision number |
3.3.2.15: trans-2,3-dihydro-3-hydroxyanthranilic acid synthase. |
|
|
|