Structure of PDB 1kcd Chain A Binding Site BS01 |
|
|
Ligand ID | GTK |
InChI | InChI=1S/C6H10O7/c7-1-2(8)6(12)13-4(1)3(9)5(10)11/h1-4,6-9,12H,(H,10,11)/t1-,2-,3+,4-,6-/m1/s1 |
InChIKey | OEVWLAOZEALENB-ORELYVPDSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(O)C(O)C1OC(O)C(O)C1O | OpenEye OEToolkits 1.7.2 | [C@H]1([C@H]([C@@H](O[C@H]1[C@@H](C(=O)O)O)O)O)O | CACTVS 3.370 | O[CH]1O[CH]([CH](O)[CH]1O)[CH](O)C(O)=O | CACTVS 3.370 | O[C@@H]1O[C@H]([C@H](O)[C@H]1O)[C@H](O)C(O)=O | OpenEye OEToolkits 1.7.2 | C1(C(C(OC1C(C(=O)O)O)O)O)O |
|
Formula | C6 H10 O7 |
Name | beta-D-galactofuranuronic acid; beta-D-galacturonic acid; D-galacturonic acid; galacturonic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 1kcd Chain A Residue 1001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|