Structure of PDB 1ap9 Chain A Binding Site BS01 |
|
|
Ligand ID | RET |
InChI | InChI=1S/C20H28O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,15H,7,10,14H2,1-5H3/b9-6+,12-11+,16-8+,17-13+ |
InChIKey | NCYCYZXNIZJOKI-OVSJKPMPSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CC(=C\C=O)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C | ACDLabs 12.01 | O=C\C=C(\C=C\C=C(\C=C\C1=C(C)CCCC1(C)C)C)C | OpenEye OEToolkits 1.7.0 | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C=O)/C)/C | OpenEye OEToolkits 1.7.0 | CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC=O)C)C | CACTVS 3.370 | CC(=CC=O)C=CC=C(C)C=CC1=C(C)CCCC1(C)C |
|
Formula | C20 H28 O |
Name | RETINAL |
ChEMBL | CHEMBL81379 |
DrugBank | |
ZINC | ZINC000004228262
|
PDB chain | 1ap9 Chain A Residue 300
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|