Structure of PDB 1aim Chain A Binding Site BS01 |
|
|
Ligand ID | ZYA |
InChI | InChI=1S/C21H23FN2O5/c1-14(19(26)12-22)23-20(27)18(11-15-7-9-17(25)10-8-15)24-21(28)29-13-16-5-3-2-4-6-16/h2-10,14,18,25H,11-13H2,1H3,(H,23,27)(H,24,28)/t14-,18-/m0/s1 |
InChIKey | RYABQRLJLIHDIP-KSSFIOAISA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CC(C(=O)CF)NC(=O)[C@H](Cc1ccc(cc1)O)NC(=O)OCc2ccccc2 | CACTVS 3.370 | C[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)OCc2ccccc2)C(=O)CF | CACTVS 3.370 | C[CH](NC(=O)[CH](Cc1ccc(O)cc1)NC(=O)OCc2ccccc2)C(=O)CF | ACDLabs 12.01 | FCC(=O)C(NC(=O)C(NC(=O)OCc1ccccc1)Cc2ccc(O)cc2)C | OpenEye OEToolkits 1.7.0 | CC(C(=O)CF)NC(=O)C(Cc1ccc(cc1)O)NC(=O)OCc2ccccc2 |
|
Formula | C21 H23 F N2 O5 |
Name | BENZOYL-TYROSINE-ALANINE-FLUORO-METHYL KETONE; Nalpha-[(benzyloxy)carbonyl]-N-[(2S)-4-fluoro-3-oxobutan-2-yl]-L-tyrosinamide |
ChEMBL | CHEMBL68828 |
DrugBank | DB08775 |
ZINC | ZINC000026272137
|
PDB chain | 1aim Chain A Residue 280
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|