Structure of PDB 1aax Chain A Binding Site BS01 |
|
|
Ligand ID | BPM |
InChI | InChI=1S/C13H14O8P2/c14-22(15,16)20-12-5-1-10(2-6-12)9-11-3-7-13(8-4-11)21-23(17,18)19/h1-8H,9H2,(H2,14,15,16)(H2,17,18,19) |
InChIKey | LGSCVLKUKMBYNC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | O[P](O)(=O)Oc1ccc(Cc2ccc(O[P](O)(O)=O)cc2)cc1 | OpenEye OEToolkits 1.7.6 | c1cc(ccc1Cc2ccc(cc2)OP(=O)(O)O)OP(=O)(O)O | ACDLabs 12.01 | O=P(O)(O)Oc1ccc(cc1)Cc2ccc(OP(=O)(O)O)cc2 |
|
Formula | C13 H14 O8 P2 |
Name | 4-PHOSPHONOOXY-PHENYL-METHYL-[4-PHOSPHONOOXY]BENZEN; bis-(para-phosphophenyl) |
ChEMBL | |
DrugBank | DB07480 |
ZINC | ZINC000003871034
|
PDB chain | 1aax Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|