Structure of PDB 7jg9 Chain 1 Binding Site BS01 |
|
|
Ligand ID | BQ1 |
InChI | InChI=1S/C32H31BrN2O2/c1-35(2)19-18-32(36,28-15-9-13-22-10-7-8-14-26(22)28)30(23-11-5-4-6-12-23)27-21-24-20-25(33)16-17-29(24)34-31(27)37-3/h4-17,20-21,30,36H,18-19H2,1-3H3/t30-,32-/m1/s1 |
InChIKey | QUIJNHUBAXPXFS-XLJNKUFUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CN(C)CC[C@@](c1cccc2c1cccc2)([C@H](c3ccccc3)c4cc5cc(ccc5nc4OC)Br)O | CACTVS 3.385 | COc1nc2ccc(Br)cc2cc1[C@@H](c3ccccc3)[C@@](O)(CCN(C)C)c4cccc5ccccc45 | CACTVS 3.385 | COc1nc2ccc(Br)cc2cc1[CH](c3ccccc3)[C](O)(CCN(C)C)c4cccc5ccccc45 | ACDLabs 12.01 | Brc1ccc2nc(OC)c(cc2c1)C(c3ccccc3)C(O)(c5c4ccccc4ccc5)CCN(C)C | OpenEye OEToolkits 1.7.6 | CN(C)CCC(c1cccc2c1cccc2)(C(c3ccccc3)c4cc5cc(ccc5nc4OC)Br)O |
|
Formula | C32 H31 Br N2 O2 |
Name | Bedaquiline |
ChEMBL | CHEMBL376488 |
DrugBank | DB08903 |
ZINC | ZINC000004655029
|
PDB chain | 7jg9 Chain 1 Residue 602
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|